C15H23N3O2S — CID 5024066
1-[1-(3,4-dimethoxyphenyl)propylideneamino]-3-propan-2-ylthiourea (PubChem CID 5024066) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)propylideneamino]-3-propan-2-ylthiourea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)propylideneamino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 5024066 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)propylideneamino]-3-propan-2-ylthiourea |
| SMILES | CCC(=NNC(=S)NC(C)C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23N3O2S/c1-6-12(17-18-15(21)16-10(2)3)11-7-8-13(19-4)14(9-11)20-5/h7-10H,6H2,1-5H3,(H2,16,18,21) |
| InChIKey | CAKYMYIPQMBADR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|