C21H26N2O3S — CID 6525597
N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-2-[(2-methylphenyl)methylsulfanyl]acetamide (PubChem CID 6525597) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-2-[(2-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-2-[(2-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 6525597 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-2-[(2-methylphenyl)methylsulfanyl]acetamide |
| SMILES | CC/C(=N/NC(=O)CSCc1ccccc1C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-5-18(16-10-11-19(25-3)20(12-16)26-4)22-23-21(24)14-27-13-17-9-7-6-8-15(17)2/h6-12H,5,13-14H2,1-4H3,(H,23,24)/b22-18- |
| InChIKey | JOYWCLCDBLFKSS-PYCFMQQDSA-N |
| XLogP | 4.18 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|