C27H27N5O4S — CID 6038578
4-[(E)-N-[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate (PubChem CID 6038578) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is 4-[(E)-N-[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate.
| Compound Name | 4-[(E)-N-[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate |
|---|---|
| PubChem CID | 6038578 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 4-[(E)-N-[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate |
| SMILES | CC/C(=N\NC(=O)CSc1n[nH]c(-c2ccc(OC)c(OC)c2)[n+]1-c1ccccc1)c1ccc([O-])cc1 |
| InChI | InChI=1S/C27H27N5O4S/c1-4-22(18-10-13-21(33)14-11-18)28-29-25(34)17-37-27-31-30-26(32(27)20-8-6-5-7-9-20)19-12-15-23(35-2)24(16-19)36-3/h5-16H,4,17H2,1-3H3,(H2,28,29,33,34) |
| InChIKey | GVKJLSRDLGRYDN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|