C26H25N5O5S — CID 5227887
4-[[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-methoxyphenolate (PubChem CID 5227887) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is 4-[[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-methoxyphenolate.
| Compound Name | 4-[[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-methoxyphenolate |
|---|---|
| PubChem CID | 5227887 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-[[[2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-methoxyphenolate |
| SMILES | COc1cc(C=NNC(=O)CSc2n[nH]c(-c3ccc(OC)c(OC)c3)[n+]2-c2ccccc2)ccc1[O-] |
| InChI | InChI=1S/C26H25N5O5S/c1-34-21-12-10-18(14-23(21)36-3)25-29-30-26(31(25)19-7-5-4-6-8-19)37-16-24(33)28-27-15-17-9-11-20(32)22(13-17)35-2/h4-15H,16H2,1-3H3,(H2,27,28,32,33) |
| InChIKey | AKSLOOSXZKTIIS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|