C29H31N5O3S — CID 46924591
4-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-ethoxyphenolate (PubChem CID 46924591) has the molecular formula C29H31N5O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is 4-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-ethoxyphenolate.
| Compound Name | 4-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-ethoxyphenolate |
|---|---|
| PubChem CID | 46924591 |
| Molecular Formula | C29H31N5O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 4-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-2-ethoxyphenolate |
| SMILES | CCOc1cc(/C=N/NC(=O)CSc2n[nH]c(-c3ccc(C(C)(C)C)cc3)[n+]2-c2ccccc2)ccc1[O-] |
| InChI | InChI=1S/C29H31N5O3S/c1-5-37-25-17-20(11-16-24(25)35)18-30-31-26(36)19-38-28-33-32-27(34(28)23-9-7-6-8-10-23)21-12-14-22(15-13-21)29(2,3)4/h6-18H,5,19H2,1-4H3,(H2,30,31,35,36) |
| InChIKey | JMTWNMYZXWBPGZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|