C29H29N5O3S — CID 4046058
4-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 4046058) has the molecular formula C29H29N5O3S and a molecular weight of 527.65 g/mol. Its IUPAC name is 4-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4046058 |
| Molecular Formula | C29H29N5O3S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 4-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | Cc1ccc(-[n+]2c(SCC(=O)NN=Cc3ccc(C(=O)[O-])cc3)n[nH]c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H29N5O3S/c1-19-5-15-24(16-6-19)34-26(21-11-13-23(14-12-21)29(2,3)4)32-33-28(34)38-18-25(35)31-30-17-20-7-9-22(10-8-20)27(36)37/h5-17H,18H2,1-4H3,(H2,31,35,36,37) |
| InChIKey | GWDVDDMCEMMQOV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|