C30H32N5O4S+ — CID 44661335
2-[2-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 44661335) has the molecular formula C30H32N5O4S+ and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[2-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 44661335 |
| Molecular Formula | C30H32N5O4S+ |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 2-[2-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(-[n+]2c(SCC(=O)N/N=C/c3ccccc3OCC(=O)O)n[nH]c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H31N5O4S/c1-20-9-15-24(16-10-20)35-28(21-11-13-23(14-12-21)30(2,3)4)33-34-29(35)40-19-26(36)32-31-17-22-7-5-6-8-25(22)39-18-27(37)38/h5-17H,18-19H2,1-4H3,(H2,32,36,37,38)/p+1/b31-17+ |
| InChIKey | GWSKHWGQIYWYJJ-KBVAKVRCSA-O |
| XLogP | 4.67 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|