C29H32N5O4S+ — CID 3887715
2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 3887715) has the molecular formula C29H32N5O4S+ and a molecular weight of 546.67 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3887715 |
| Molecular Formula | C29H32N5O4S+ |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(-[n+]2c(SCC(=O)NN=Cc3cccc(OC)c3O)n[nH]c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H31N5O4S/c1-29(2,3)21-11-9-19(10-12-21)27-32-33-28(34(27)22-13-15-23(37-4)16-14-22)39-18-25(35)31-30-17-20-7-6-8-24(38-5)26(20)36/h6-17H,18H2,1-5H3,(H2,30,31,35,36)/p+1 |
| InChIKey | MBGAMTDKHIQRGI-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|