C26H26N5O4S+ — CID 135630120
N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide (PubChem CID 135630120) has the molecular formula C26H26N5O4S+ and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135630120 |
| Molecular Formula | C26H26N5O4S+ |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1cccc(/C=N\NC(=O)CSc2n[nH]c(-c3ccc(OC)cc3)[n+]2-c2ccccc2)c1O |
| InChI | InChI=1S/C26H25N5O4S/c1-3-35-22-11-7-8-19(24(22)33)16-27-28-23(32)17-36-26-30-29-25(18-12-14-21(34-2)15-13-18)31(26)20-9-5-4-6-10-20/h4-16H,3,17H2,1-2H3,(H2,27,28,32,33)/p+1 |
| InChIKey | MUBSRQYDTXRBQS-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|