C28H27Br2N5O2S — CID 53367607
2,4-dibromo-6-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate (PubChem CID 53367607) has the molecular formula C28H27Br2N5O2S and a molecular weight of 657.43 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate.
| Compound Name | 2,4-dibromo-6-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 53367607 |
| Molecular Formula | C28H27Br2N5O2S |
| Molecular Weight | 657.43 g/mol |
| Exact Mass | 655.03 |
| IUPAC Name | 2,4-dibromo-6-[(E)-[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
| SMILES | Cc1ccc(-[n+]2c(SCC(=O)N/N=C/c3cc(Br)cc(Br)c3[O-])n[nH]c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H27Br2N5O2S/c1-17-5-11-22(12-6-17)35-26(18-7-9-20(10-8-18)28(2,3)4)33-34-27(35)38-16-24(36)32-31-15-19-13-21(29)14-23(30)25(19)37/h5-15H,16H2,1-4H3,(H2,31,32,36,37) |
| InChIKey | GVZMIAXNEIHRCB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|