C25H21Br2N5O3S — CID 53367576
2,4-dibromo-6-[(E)-[[2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate (PubChem CID 53367576) has the molecular formula C25H21Br2N5O3S and a molecular weight of 631.35 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-[[2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate.
| Compound Name | 2,4-dibromo-6-[(E)-[[2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 53367576 |
| Molecular Formula | C25H21Br2N5O3S |
| Molecular Weight | 631.35 g/mol |
| Exact Mass | 628.97 |
| IUPAC Name | 2,4-dibromo-6-[(E)-[[2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
| SMILES | COc1ccc(-c2[nH]nc(SCC(=O)N/N=C/c3cc(Br)cc(Br)c3[O-])[n+]2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H21Br2N5O3S/c1-15-3-7-19(8-4-15)32-24(16-5-9-20(35-2)10-6-16)30-31-25(32)36-14-22(33)29-28-13-17-11-18(26)12-21(27)23(17)34/h3-13H,14H2,1-2H3,(H2,28,29,33,34) |
| InChIKey | ONEGPPDEGMVXDL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|