C24H21ClN5O4S+ — CID 135614092
2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 135614092) has the molecular formula C24H21ClN5O4S+ and a molecular weight of 510.98 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135614092 |
| Molecular Formula | C24H21ClN5O4S+ |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(-c2[nH]nc(SCC(=O)N/N=C/c3ccc(O)cc3O)[n+]2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20ClN5O4S/c1-34-20-10-3-15(4-11-20)23-28-29-24(30(23)18-7-5-17(25)6-8-18)35-14-22(33)27-26-13-16-2-9-19(31)12-21(16)32/h2-13H,14H2,1H3,(H3,26,27,31,32,33)/p+1 |
| InChIKey | ZPFBXJYJINUKJW-UHFFFAOYSA-O |
| XLogP | 3.67 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|