C19H19ClN5O3S+ — CID 5021125
2-[[5-(4-chlorophenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 5021125) has the molecular formula C19H19ClN5O3S+ and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5021125 |
| Molecular Formula | C19H19ClN5O3S+ |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | CC[n+]1c(SCC(=O)NN=Cc2ccc(O)cc2O)n[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN5O3S/c1-2-25-18(12-3-6-14(20)7-4-12)23-24-19(25)29-11-17(28)22-21-10-13-5-8-15(26)9-16(13)27/h3-10H,2,11H2,1H3,(H3,21,22,26,27,28)/p+1 |
| InChIKey | FDSVWQJUJVHMCT-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|