C23H27N5O3S — CID 4023654
2-[[[2-[[5-(4-tert-butylphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-hydroxyphenolate (PubChem CID 4023654) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[[[2-[[5-(4-tert-butylphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-hydroxyphenolate.
| Compound Name | 2-[[[2-[[5-(4-tert-butylphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-hydroxyphenolate |
|---|---|
| PubChem CID | 4023654 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[[[2-[[5-(4-tert-butylphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-hydroxyphenolate |
| SMILES | CC[n+]1c(SCC(=O)NN=Cc2ccc(O)cc2[O-])n[nH]c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H27N5O3S/c1-5-28-21(15-6-9-17(10-7-15)23(2,3)4)26-27-22(28)32-14-20(31)25-24-13-16-8-11-18(29)12-19(16)30/h6-13H,5,14H2,1-4H3,(H3,24,25,29,30,31) |
| InChIKey | LKRDXFXHSWGXFY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|