C19H17I2N5O2S — CID 3939948
2-[[[2-[(4-ethyl-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-4,6-diiodophenolate (PubChem CID 3939948) has the molecular formula C19H17I2N5O2S and a molecular weight of 633.25 g/mol. Its IUPAC name is 2-[[[2-[(4-ethyl-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-4,6-diiodophenolate.
| Compound Name | 2-[[[2-[(4-ethyl-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-4,6-diiodophenolate |
|---|---|
| PubChem CID | 3939948 |
| Molecular Formula | C19H17I2N5O2S |
| Molecular Weight | 633.25 g/mol |
| Exact Mass | 632.92 |
| IUPAC Name | 2-[[[2-[(4-ethyl-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-4,6-diiodophenolate |
| SMILES | CC[n+]1c(SCC(=O)NN=Cc2cc(I)cc(I)c2[O-])n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C19H17I2N5O2S/c1-2-26-18(12-6-4-3-5-7-12)24-25-19(26)29-11-16(27)23-22-10-13-8-14(20)9-15(21)17(13)28/h3-10H,2,11H2,1H3,(H2,22,23,27,28) |
| InChIKey | YKZNELGYIDMWNJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|