C26H25ClN5O4S+ — CID 135651061
2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide (PubChem CID 135651061) has the molecular formula C26H25ClN5O4S+ and a molecular weight of 539.04 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 135651061 |
| Molecular Formula | C26H25ClN5O4S+ |
| Molecular Weight | 539.04 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]acetamide |
| SMILES | COc1ccc(-c2[nH]nc(SCC(=O)N/N=C(/C)c3ccc(O)c(OC)c3)[n+]2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H24ClN5O4S/c1-16(18-6-13-22(33)23(14-18)36-3)28-29-24(34)15-37-26-31-30-25(17-4-11-21(35-2)12-5-17)32(26)20-9-7-19(27)8-10-20/h4-14H,15H2,1-3H3,(H2,28,29,33,34)/p+1 |
| InChIKey | WRJPDRWBVKHEKJ-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.04 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|