C25H23ClN5O2S+ — CID 4240673
2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[1-(3-hydroxyphenyl)ethylideneamino]acetamide (PubChem CID 4240673) has the molecular formula C25H23ClN5O2S+ and a molecular weight of 493.01 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[1-(3-hydroxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[1-(3-hydroxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 4240673 |
| Molecular Formula | C25H23ClN5O2S+ |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[1-(3-hydroxyphenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CSc1n[nH]c(-c2ccc(Cl)cc2)[n+]1-c1ccc(C)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C25H22ClN5O2S/c1-16-6-12-21(13-7-16)31-24(18-8-10-20(26)11-9-18)29-30-25(31)34-15-23(33)28-27-17(2)19-4-3-5-22(32)14-19/h3-14H,15H2,1-2H3,(H2,28,32,33)/p+1 |
| InChIKey | PCBSSWAPFXIFJS-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|