C25H24N5O2S+ — CID 135650829
N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-2-[[4-(4-methylphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide (PubChem CID 135650829) has the molecular formula C25H24N5O2S+ and a molecular weight of 458.57 g/mol. Its IUPAC name is N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-2-[[4-(4-methylphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-2-[[4-(4-methylphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135650829 |
| Molecular Formula | C25H24N5O2S+ |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[(Z)-1-(4-hydroxyphenyl)ethylideneamino]-2-[[4-(4-methylphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide |
| SMILES | C/C(=N/NC(=O)CSc1n[nH]c(-c2ccccc2)[n+]1-c1ccc(C)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H23N5O2S/c1-17-8-12-21(13-9-17)30-24(20-6-4-3-5-7-20)28-29-25(30)33-16-23(32)27-26-18(2)19-10-14-22(31)15-11-19/h3-15H,16H2,1-2H3,(H2,26,27,31,32)/p+1 |
| InChIKey | PISYKKSFLODYSY-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|