C24H27ClN5O2S+ — CID 6787124
2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(3-hydroxyphenyl)ethylideneamino]acetamide (PubChem CID 6787124) has the molecular formula C24H27ClN5O2S+ and a molecular weight of 485.03 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(3-hydroxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(3-hydroxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6787124 |
| Molecular Formula | C24H27ClN5O2S+ |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(Z)-1-(3-hydroxyphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CSc1n[nH]c(-c2ccc(Cl)cc2)[n+]1C1CCCCC1)c1cccc(O)c1 |
| InChI | InChI=1S/C24H26ClN5O2S/c1-16(18-6-5-9-21(31)14-18)26-27-22(32)15-33-24-29-28-23(17-10-12-19(25)13-11-17)30(24)20-7-3-2-4-8-20/h5-6,9-14,20H,2-4,7-8,15H2,1H3,(H2,27,31,32)/p+1/b26-16- |
| InChIKey | ZJFOCSWSEIHKOQ-QQXSKIMKSA-O |
| XLogP | 4.86 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|