C24H25ClN5O3S+ — CID 53367599
2-[(E)-[[2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 53367599) has the molecular formula C24H25ClN5O3S+ and a molecular weight of 499.02 g/mol. Its IUPAC name is 2-[(E)-[[2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[[2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 53367599 |
| Molecular Formula | C24H25ClN5O3S+ |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 2-[(E)-[[2-[[5-(4-chlorophenyl)-4-cyclohexyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(CSc1n[nH]c(-c2ccc(Cl)cc2)[n+]1C1CCCCC1)N/N=C/c1ccccc1C(=O)O |
| InChI | InChI=1S/C24H24ClN5O3S/c25-18-12-10-16(11-13-18)22-28-29-24(30(22)19-7-2-1-3-8-19)34-15-21(31)27-26-14-17-6-4-5-9-20(17)23(32)33/h4-6,9-14,19H,1-3,7-8,15H2,(H2,27,31,32,33)/p+1/b26-14+ |
| InChIKey | LWJPPQONWLAZFS-VULFUBBASA-O |
| XLogP | 4.46 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|