C26H24ClN5O3S — CID 4518184
2-[N-[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate (PubChem CID 4518184) has the molecular formula C26H24ClN5O3S and a molecular weight of 522.03 g/mol. Its IUPAC name is 2-[N-[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate.
| Compound Name | 2-[N-[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate |
|---|---|
| PubChem CID | 4518184 |
| Molecular Formula | C26H24ClN5O3S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-[N-[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate |
| SMILES | CCOc1ccc(-[n+]2c(SCC(=O)NN=C(C)c3ccccc3[O-])n[nH]c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H24ClN5O3S/c1-3-35-21-14-12-20(13-15-21)32-25(18-8-10-19(27)11-9-18)30-31-26(32)36-16-24(34)29-28-17(2)22-6-4-5-7-23(22)33/h4-15H,3,16H2,1-2H3,(H2,28,29,33,34) |
| InChIKey | OHLDRGBJJYRYII-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|