C25H22ClN5O3S — CID 5219264
3-[[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate (PubChem CID 5219264) has the molecular formula C25H22ClN5O3S and a molecular weight of 508.00 g/mol. Its IUPAC name is 3-[[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate.
| Compound Name | 3-[[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 5219264 |
| Molecular Formula | C25H22ClN5O3S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 3-[[[2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
| SMILES | CCOc1ccc(-[n+]2c(SCC(=O)NN=Cc3cccc([O-])c3)n[nH]c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H22ClN5O3S/c1-2-34-22-12-10-20(11-13-22)31-24(18-6-8-19(26)9-7-18)29-30-25(31)35-16-23(33)28-27-15-17-4-3-5-21(32)14-17/h3-15H,2,16H2,1H3,(H2,28,32,33) |
| InChIKey | WLRDVLVLRASPAX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|