C25H24N5O3S+ — CID 3305725
2-[[4-(4-ethoxyphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 3305725) has the molecular formula C25H24N5O3S+ and a molecular weight of 474.57 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-ethoxyphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3305725 |
| Molecular Formula | C25H24N5O3S+ |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[[4-(4-ethoxyphenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(-[n+]2c(SCC(=O)NN=Cc3cccc(O)c3)n[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N5O3S/c1-2-33-22-13-11-20(12-14-22)30-24(19-8-4-3-5-9-19)28-29-25(30)34-17-23(32)27-26-16-18-7-6-10-21(31)15-18/h3-16H,2,17H2,1H3,(H2,27,31,32)/p+1 |
| InChIKey | JNDZBVRRRLVCON-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|