C24H20BrN5O3S — CID 53367544
2-[(E)-[[2-[[4-(4-bromophenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxyphenolate (PubChem CID 53367544) has the molecular formula C24H20BrN5O3S and a molecular weight of 538.43 g/mol. Its IUPAC name is 2-[(E)-[[2-[[4-(4-bromophenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxyphenolate.
| Compound Name | 2-[(E)-[[2-[[4-(4-bromophenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxyphenolate |
|---|---|
| PubChem CID | 53367544 |
| Molecular Formula | C24H20BrN5O3S |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | 2-[(E)-[[2-[[4-(4-bromophenyl)-5-phenyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-6-methoxyphenolate |
| SMILES | COc1cccc(/C=N/NC(=O)CSc2n[nH]c(-c3ccccc3)[n+]2-c2ccc(Br)cc2)c1[O-] |
| InChI | InChI=1S/C24H20BrN5O3S/c1-33-20-9-5-8-17(22(20)32)14-26-27-21(31)15-34-24-29-28-23(16-6-3-2-4-7-16)30(24)19-12-10-18(25)11-13-19/h2-14H,15H2,1H3,(H2,26,27,31,32) |
| InChIKey | UOHGMODIPKUFLQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|