C24H18Br2ClN5O2S — CID 3252361
2,4-dibromo-6-[[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate (PubChem CID 3252361) has the molecular formula C24H18Br2ClN5O2S and a molecular weight of 635.77 g/mol. Its IUPAC name is 2,4-dibromo-6-[[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate.
| Compound Name | 2,4-dibromo-6-[[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 3252361 |
| Molecular Formula | C24H18Br2ClN5O2S |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 632.92 |
| IUPAC Name | 2,4-dibromo-6-[[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenolate |
| SMILES | Cc1ccc(-[n+]2c(SCC(=O)NN=Cc3cc(Br)cc(Br)c3[O-])n[nH]c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H18Br2ClN5O2S/c1-14-2-8-19(9-3-14)32-23(15-4-6-18(27)7-5-15)30-31-24(32)35-13-21(33)29-28-12-16-10-17(25)11-20(26)22(16)34/h2-12H,13H2,1H3,(H2,28,29,33,34) |
| InChIKey | KPDFSJLTJDVPCC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|