C27H28N5O5S+ — CID 3951261
N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide (PubChem CID 3951261) has the molecular formula C27H28N5O5S+ and a molecular weight of 534.62 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide.
| Compound Name | N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3951261 |
| Molecular Formula | C27H28N5O5S+ |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetamide |
| SMILES | COc1cc(-c2[nH]nc(SCC(=O)NN=C(C)c3ccccc3O)[n+]2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H27N5O5S/c1-17(20-12-8-9-13-21(20)33)28-29-24(34)16-38-27-31-30-26(32(27)19-10-6-5-7-11-19)18-14-22(35-2)25(37-4)23(15-18)36-3/h5-15H,16H2,1-4H3,(H2,28,29,33,34)/p+1 |
| InChIKey | QHACWWQCYPFKNW-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|