C13H14O7 — CID 168859769
4-(4-methoxy-3-methoxycarbonyloxyphenyl)-4-oxobutanoic acid (PubChem CID 168859769) has the molecular formula C13H14O7 and a molecular weight of 282.25 g/mol. Its IUPAC name is 4-(4-methoxy-3-methoxycarbonyloxyphenyl)-4-oxobutanoic acid.
| Compound Name | 4-(4-methoxy-3-methoxycarbonyloxyphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 168859769 |
| Molecular Formula | C13H14O7 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-(4-methoxy-3-methoxycarbonyloxyphenyl)-4-oxobutanoic acid |
| SMILES | COC(=O)Oc1cc(C(=O)CCC(=O)O)ccc1OC |
| InChI | InChI=1S/C13H14O7/c1-18-10-5-3-8(9(14)4-6-12(15)16)7-11(10)20-13(17)19-2/h3,5,7H,4,6H2,1-2H3,(H,15,16) |
| InChIKey | VGTVTRCIKKGNDF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|