C19H27NO4 — CID 17457747
N-cycloheptyl-4-(3,4-dimethoxyphenyl)-4-oxobutanamide (PubChem CID 17457747) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-cycloheptyl-4-(3,4-dimethoxyphenyl)-4-oxobutanamide.
| Compound Name | N-cycloheptyl-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 17457747 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-cycloheptyl-4-(3,4-dimethoxyphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)NC2CCCCCC2)cc1OC |
| InChI | InChI=1S/C19H27NO4/c1-23-17-11-9-14(13-18(17)24-2)16(21)10-12-19(22)20-15-7-5-3-4-6-8-15/h9,11,13,15H,3-8,10,12H2,1-2H3,(H,20,22) |
| InChIKey | PDOSGIKVMSQRKS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |