C20H26FNO5 — CID 120688810
2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]cyclooctane-1-carboxylic acid (PubChem CID 120688810) has the molecular formula C20H26FNO5 and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]cyclooctane-1-carboxylic acid.
| Compound Name | 2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 120688810 |
| Molecular Formula | C20H26FNO5 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]cyclooctane-1-carboxylic acid |
| SMILES | COc1ccc(C(=O)CCC(=O)NC2CCCCCCC2C(=O)O)cc1F |
| InChI | InChI=1S/C20H26FNO5/c1-27-18-10-8-13(12-15(18)21)17(23)9-11-19(24)22-16-7-5-3-2-4-6-14(16)20(25)26/h8,10,12,14,16H,2-7,9,11H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | UNQYMWPWSQKZIU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |