C10H14ClNO3 — CID 16740542
[2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride (PubChem CID 16740542) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride |
|---|---|
| PubChem CID | 16740542 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride |
| SMILES | COc1ccc(C(=O)C[NH3+])cc1OC.[Cl-] |
| InChI | InChI=1S/C10H13NO3.ClH/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2;/h3-5H,6,11H2,1-2H3;1H |
| InChIKey | ZULGIQDFVVMFMI-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |