[2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride

C10H14ClNO3 — CID 16740542

IUPAC[2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride
SMILESCOc1ccc(C(=O)C[NH3+])cc1OC.[Cl-]
InChIInChI=1S/C10H13NO3.ClH/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2;/h3-5H,6,11H2,1-2H3;1H
InChIKeyZULGIQDFVVMFMI-UHFFFAOYSA-N
MW231.68 g/mol
LogP-2.87
Rot. Bonds4

About [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride

[2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride (PubChem CID 16740542) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride.

Molecular Properties

Compound Name[2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride
PubChem CID16740542
Molecular FormulaC10H14ClNO3
Molecular Weight231.68 g/mol
Exact Mass231.07
IUPAC Name[2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride
SMILESCOc1ccc(C(=O)C[NH3+])cc1OC.[Cl-]
InChIInChI=1S/C10H13NO3.ClH/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2;/h3-5H,6,11H2,1-2H3;1H
InChIKeyZULGIQDFVVMFMI-UHFFFAOYSA-N
XLogP-2.87
TPSA63.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.68
LogP ≤ 5-2.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride?
The IUPAC name of [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride (CID 16740542) is [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride.
What is the SMILES notation for [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride?
The canonical SMILES for [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride is COc1ccc(C(=O)C[NH3+])cc1OC.[Cl-].
What is the InChIKey of [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride?
The InChIKey is ZULGIQDFVVMFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3.ClH/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2;/h3-5H,6,11H2,1-2H3;1H.
What are the key properties of [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride?
[2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride has a molecular weight of 231.68 g/mol, XLogP of -2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethoxyphenyl)-2-oxoethyl]azanium chloride is sourced from PubChem (CID 16740542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).