C16H15Cl2N3OS — CID 3441173
1-[1-(3,4-dichlorophenyl)ethylideneamino]-3-(2-methoxyphenyl)thiourea (PubChem CID 3441173) has the molecular formula C16H15Cl2N3OS and a molecular weight of 368.29 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethylideneamino]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethylideneamino]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3441173 |
| Molecular Formula | C16H15Cl2N3OS |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethylideneamino]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)NN=C(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N3OS/c1-10(11-7-8-12(17)13(18)9-11)20-21-16(23)19-14-5-3-4-6-15(14)22-2/h3-9H,1-2H3,(H2,19,21,23) |
| InChIKey | HHQOIBIOLWUUQD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|