C22H20Cl2N4O2S2 — CID 1252379
1-[2,5-dichloro-4-[(2-methoxyphenyl)carbamothioylamino]phenyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 1252379) has the molecular formula C22H20Cl2N4O2S2 and a molecular weight of 507.47 g/mol. Its IUPAC name is 1-[2,5-dichloro-4-[(2-methoxyphenyl)carbamothioylamino]phenyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[2,5-dichloro-4-[(2-methoxyphenyl)carbamothioylamino]phenyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 1252379 |
| Molecular Formula | C22H20Cl2N4O2S2 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | 1-[2,5-dichloro-4-[(2-methoxyphenyl)carbamothioylamino]phenyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)Nc1cc(Cl)c(NC(=S)Nc2ccccc2OC)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N4O2S2/c1-29-19-9-5-3-7-15(19)25-21(31)27-17-11-14(24)18(12-13(17)23)28-22(32)26-16-8-4-6-10-20(16)30-2/h3-12H,1-2H3,(H2,25,27,31)(H2,26,28,32) |
| InChIKey | KCXUSCDZQVEBAX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|