C10H14N2OS — CID 686501
1-ethyl-3-(2-methoxyphenyl)thiourea (PubChem CID 686501) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-ethyl-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 686501 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-ethyl-3-(2-methoxyphenyl)thiourea |
| SMILES | CCNC(=S)Nc1ccccc1OC |
| InChI | InChI=1S/C10H14N2OS/c1-3-11-10(14)12-8-6-4-5-7-9(8)13-2/h4-7H,3H2,1-2H3,(H2,11,12,14) |
| InChIKey | MDCLIBDOUDZJMY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|