C21H28N4O2S2 — CID 4536659
1-(2-methoxyphenyl)-3-[1-[(2-methoxyphenyl)carbamothioylamino]pentan-3-yl]thiourea (PubChem CID 4536659) has the molecular formula C21H28N4O2S2 and a molecular weight of 432.62 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[1-[(2-methoxyphenyl)carbamothioylamino]pentan-3-yl]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[1-[(2-methoxyphenyl)carbamothioylamino]pentan-3-yl]thiourea |
|---|---|
| PubChem CID | 4536659 |
| Molecular Formula | C21H28N4O2S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[1-[(2-methoxyphenyl)carbamothioylamino]pentan-3-yl]thiourea |
| SMILES | CCC(CCNC(=S)Nc1ccccc1OC)NC(=S)Nc1ccccc1OC |
| InChI | InChI=1S/C21H28N4O2S2/c1-4-15(23-21(29)25-17-10-6-8-12-19(17)27-3)13-14-22-20(28)24-16-9-5-7-11-18(16)26-2/h5-12,15H,4,13-14H2,1-3H3,(H2,22,24,28)(H2,23,25,29) |
| InChIKey | MAKPHTBUAHJPER-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|