C23H28N4O2S2 — CID 40857563
1-(4-acetylphenyl)-3-[(3S)-1-[(4-acetylphenyl)carbamothioylamino]pentan-3-yl]thiourea (PubChem CID 40857563) has the molecular formula C23H28N4O2S2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[(3S)-1-[(4-acetylphenyl)carbamothioylamino]pentan-3-yl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[(3S)-1-[(4-acetylphenyl)carbamothioylamino]pentan-3-yl]thiourea |
|---|---|
| PubChem CID | 40857563 |
| Molecular Formula | C23H28N4O2S2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[(3S)-1-[(4-acetylphenyl)carbamothioylamino]pentan-3-yl]thiourea |
| SMILES | CC[C@@H](CCNC(=S)Nc1ccc(C(C)=O)cc1)NC(=S)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C23H28N4O2S2/c1-4-19(25-23(31)27-21-11-7-18(8-12-21)16(3)29)13-14-24-22(30)26-20-9-5-17(6-10-20)15(2)28/h5-12,19H,4,13-14H2,1-3H3,(H2,24,26,30)(H2,25,27,31)/t19-/m0/s1 |
| InChIKey | KUNBAPOSSSJHJH-IBGZPJMESA-N |
| XLogP | 4.53 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|