C21H28N4O4 — CID 55629361
1-(4-methoxyphenyl)-3-[1-[(4-methoxyphenyl)carbamoylamino]pentan-3-yl]urea (PubChem CID 55629361) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[1-[(4-methoxyphenyl)carbamoylamino]pentan-3-yl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[1-[(4-methoxyphenyl)carbamoylamino]pentan-3-yl]urea |
|---|---|
| PubChem CID | 55629361 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[1-[(4-methoxyphenyl)carbamoylamino]pentan-3-yl]urea |
| SMILES | CCC(CCNC(=O)Nc1ccc(OC)cc1)NC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28N4O4/c1-4-15(23-21(27)25-17-7-11-19(29-3)12-8-17)13-14-22-20(26)24-16-5-9-18(28-2)10-6-16/h5-12,15H,4,13-14H2,1-3H3,(H2,22,24,26)(H2,23,25,27) |
| InChIKey | LIYPKCYGYFTICV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |