C14H22N2O2 — CID 21361439
1-(3,3-dimethylbutyl)-3-(4-methoxyphenyl)urea (PubChem CID 21361439) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(3,3-dimethylbutyl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 21361439 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H22N2O2/c1-14(2,3)9-10-15-13(17)16-11-5-7-12(18-4)8-6-11/h5-8H,9-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | PCHNVQUWFDSNGK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |