C30H32N4O6 — CID 139045428
1,3-bis(4-methoxyphenyl)urea (PubChem CID 139045428) has the molecular formula C30H32N4O6 and a molecular weight of 544.61 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)urea.
| Compound Name | 1,3-bis(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 139045428 |
| Molecular Formula | C30H32N4O6 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(OC)cc2)cc1.COc1ccc(NC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/2C15H16N2O3/c2*1-19-13-7-3-11(4-8-13)16-15(18)17-12-5-9-14(20-2)10-6-12/h2*3-10H,1-2H3,(H2,16,17,18) |
| InChIKey | BJZKUPFAWGEKTF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |