C26H24N4O4 — CID 102497884
1-(4-methoxyphenyl)-3-[8-[(4-methoxyphenyl)carbamoylamino]naphthalen-1-yl]urea (PubChem CID 102497884) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[8-[(4-methoxyphenyl)carbamoylamino]naphthalen-1-yl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[8-[(4-methoxyphenyl)carbamoylamino]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 102497884 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[8-[(4-methoxyphenyl)carbamoylamino]naphthalen-1-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cccc3cccc(NC(=O)Nc4ccc(OC)cc4)c23)cc1 |
| InChI | InChI=1S/C26H24N4O4/c1-33-20-13-9-18(10-14-20)27-25(31)29-22-7-3-5-17-6-4-8-23(24(17)22)30-26(32)28-19-11-15-21(34-2)16-12-19/h3-16H,1-2H3,(H2,27,29,31)(H2,28,30,32) |
| InChIKey | BFVFWHMCDSQGQF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |