C19H24N2O3 — CID 121112426
1-(5-hydroxy-3-phenylpentyl)-3-(4-methoxyphenyl)urea (PubChem CID 121112426) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-(5-hydroxy-3-phenylpentyl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(5-hydroxy-3-phenylpentyl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 121112426 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-(5-hydroxy-3-phenylpentyl)-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCCC(CCO)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-24-18-9-7-17(8-10-18)21-19(23)20-13-11-16(12-14-22)15-5-3-2-4-6-15/h2-10,16,22H,11-14H2,1H3,(H2,20,21,23) |
| InChIKey | LHZFQZSAJTYOOW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |