C20H21F3N2O4 — CID 99872932
N-[(3R)-5-hydroxy-3-phenylpentyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide (PubChem CID 99872932) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is N-[(3R)-5-hydroxy-3-phenylpentyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide.
| Compound Name | N-[(3R)-5-hydroxy-3-phenylpentyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 99872932 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[(3R)-5-hydroxy-3-phenylpentyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide |
| SMILES | O=C(NCC[C@H](CCO)c1ccccc1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O4/c21-20(22,23)29-17-8-6-16(7-9-17)25-19(28)18(27)24-12-10-15(11-13-26)14-4-2-1-3-5-14/h1-9,15,26H,10-13H2,(H,24,27)(H,25,28)/t15-/m1/s1 |
| InChIKey | BYCFOFJMAAAELR-OAHLLOKOSA-N |
| XLogP | 3.20 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|