C18H20F3NO4S — CID 99872886
N-[(3S)-5-hydroxy-3-phenylpentyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 99872886) has the molecular formula C18H20F3NO4S and a molecular weight of 403.42 g/mol. Its IUPAC name is N-[(3S)-5-hydroxy-3-phenylpentyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(3S)-5-hydroxy-3-phenylpentyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 99872886 |
| Molecular Formula | C18H20F3NO4S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[(3S)-5-hydroxy-3-phenylpentyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCC[C@@H](CCO)c1ccccc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F3NO4S/c19-18(20,21)26-16-6-8-17(9-7-16)27(24,25)22-12-10-15(11-13-23)14-4-2-1-3-5-14/h1-9,15,22-23H,10-13H2/t15-/m0/s1 |
| InChIKey | HTLPVVKUVFOLCP-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |