C17H18F3NO4S — CID 11509340
N-(4-hydroxybutyl)-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 11509340) has the molecular formula C17H18F3NO4S and a molecular weight of 389.40 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | N-(4-hydroxybutyl)-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11509340 |
| Molecular Formula | C17H18F3NO4S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(4-hydroxybutyl)-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCO)c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H18F3NO4S/c18-17(19,20)25-15-7-3-13(4-8-15)14-5-9-16(10-6-14)26(23,24)21-11-1-2-12-22/h3-10,21-22H,1-2,11-12H2 |
| InChIKey | PPSAMQQBONEVER-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|