C19H32Cl2F3N3O3S — CID 139937507
N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-(trifluoromethoxy)benzenesulfonamide;dihydrochloride (PubChem CID 139937507) has the molecular formula C19H32Cl2F3N3O3S and a molecular weight of 510.45 g/mol. Its IUPAC name is N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-(trifluoromethoxy)benzenesulfonamide;dihydrochloride.
| Compound Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-(trifluoromethoxy)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 139937507 |
| Molecular Formula | C19H32Cl2F3N3O3S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-(trifluoromethoxy)benzenesulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(NCCCCNCCNC1CCCCC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H30F3N3O3S.2ClH/c20-19(21,22)28-17-8-10-18(11-9-17)29(26,27)25-13-5-4-12-23-14-15-24-16-6-2-1-3-7-16;;/h8-11,16,23-25H,1-7,12-15H2;2*1H |
| InChIKey | BXAYQWLRERQLNO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|