C15H19F3N2O4S — CID 163523295
1-cycloheptyl-3-[4-(trifluoromethoxy)phenyl]sulfonylurea (PubChem CID 163523295) has the molecular formula C15H19F3N2O4S and a molecular weight of 380.39 g/mol. Its IUPAC name is 1-cycloheptyl-3-[4-(trifluoromethoxy)phenyl]sulfonylurea.
| Compound Name | 1-cycloheptyl-3-[4-(trifluoromethoxy)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 163523295 |
| Molecular Formula | C15H19F3N2O4S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-cycloheptyl-3-[4-(trifluoromethoxy)phenyl]sulfonylurea |
| SMILES | O=C(NC1CCCCCC1)NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O4S/c16-15(17,18)24-12-7-9-13(10-8-12)25(22,23)20-14(21)19-11-5-3-1-2-4-6-11/h7-11H,1-6H2,(H2,19,20,21) |
| InChIKey | DMRNUGUDGCPNAG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |