C14H17F3N2O3S — CID 154259938
1-cyclohexyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea (PubChem CID 154259938) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea.
| Compound Name | 1-cyclohexyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 154259938 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-cyclohexyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea |
| SMILES | O=C(NC1CCCCC1)NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O3S/c15-14(16,17)10-5-4-8-12(9-10)23(21,22)19-13(20)18-11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7H2,(H2,18,19,20) |
| InChIKey | NCSSCUXXURZTOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |