C15H20F3NO3S — CID 56764333
N-(2-cyclohexyl-2-hydroxyethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 56764333) has the molecular formula C15H20F3NO3S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(2-cyclohexyl-2-hydroxyethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-cyclohexyl-2-hydroxyethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 56764333 |
| Molecular Formula | C15H20F3NO3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(2-cyclohexyl-2-hydroxyethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(O)C1CCCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO3S/c16-15(17,18)12-7-4-8-13(9-12)23(21,22)19-10-14(20)11-5-2-1-3-6-11/h4,7-9,11,14,19-20H,1-3,5-6,10H2 |
| InChIKey | UUGANMIJBMDXKH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |