C21H18F3NO2S — CID 3312193
N-(2,2-diphenylethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 3312193) has the molecular formula C21H18F3NO2S and a molecular weight of 405.44 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2,2-diphenylethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3312193 |
| Molecular Formula | C21H18F3NO2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(2,2-diphenylethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccccc1)c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3NO2S/c22-21(23,24)18-12-7-13-19(14-18)28(26,27)25-15-20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-14,20,25H,15H2 |
| InChIKey | GQEVOJYUXYPJRV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |