C11H13BrF3NO3S — CID 114296184
N-(2-bromo-3-methoxypropyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 114296184) has the molecular formula C11H13BrF3NO3S and a molecular weight of 376.19 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-bromo-3-methoxypropyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114296184 |
| Molecular Formula | C11H13BrF3NO3S |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COCC(Br)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13BrF3NO3S/c1-19-7-9(12)6-16-20(17,18)10-4-2-3-8(5-10)11(13,14)15/h2-5,9,16H,6-7H2,1H3 |
| InChIKey | UJMPDSBKEZVXSY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|