C16H13F6NO3S — CID 90534857
N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 90534857) has the molecular formula C16H13F6NO3S and a molecular weight of 413.34 g/mol. Its IUPAC name is N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90534857 |
| Molecular Formula | C16H13F6NO3S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(O)c1ccc(C(F)(F)F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F6NO3S/c17-15(18,19)11-6-4-10(5-7-11)14(24)9-23-27(25,26)13-3-1-2-12(8-13)16(20,21)22/h1-8,14,23-24H,9H2 |
| InChIKey | QJAZSTGVLOSTQJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |